C20H17N5S — CID 168577322
4-phenyl-N-[[4-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168577322) has the molecular formula C20H17N5S and a molecular weight of 359.46 g/mol. Its IUPAC name is 4-phenyl-N-[[4-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-phenyl-N-[[4-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577322 |
| Molecular Formula | C20H17N5S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-phenyl-N-[[4-(pyrazol-1-ylmethyl)phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | C(=NNc1nc(-c2ccccc2)cs1)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C20H17N5S/c1-2-5-18(6-3-1)19-15-26-20(23-19)24-21-13-16-7-9-17(10-8-16)14-25-12-4-11-22-25/h1-13,15H,14H2,(H,23,24) |
| InChIKey | FQQNMDGRXSXTDK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|