C13H12N6S2 — CID 2867543
4-methyl-5-[2-[2-(pyridin-3-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]-1,3-thiazol-2-amine (PubChem CID 2867543) has the molecular formula C13H12N6S2 and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-methyl-5-[2-[2-(pyridin-3-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-[2-[2-(pyridin-3-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2867543 |
| Molecular Formula | C13H12N6S2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-methyl-5-[2-[2-(pyridin-3-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1-c1csc(NN=Cc2cccnc2)n1 |
| InChI | InChI=1S/C13H12N6S2/c1-8-11(21-12(14)17-8)10-7-20-13(18-10)19-16-6-9-3-2-4-15-5-9/h2-7H,1H3,(H2,14,17)(H,18,19) |
| InChIKey | ZLOHRHUNUWQDDZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|