C15H12N4O2S — CID 45124176
4-[2-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 45124176) has the molecular formula C15H12N4O2S and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-[2-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzene-1,3-diol.
| Compound Name | 4-[2-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 45124176 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-[2-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-c2csc(N/N=C/c3cccnc3)n2)c(O)c1 |
| InChI | InChI=1S/C15H12N4O2S/c20-11-3-4-12(14(21)6-11)13-9-22-15(18-13)19-17-8-10-2-1-5-16-7-10/h1-9,20-21H,(H,18,19)/b17-8+ |
| InChIKey | UNIIXYJOCOUGNB-CAOOACKPSA-N |
| XLogP | 3.06 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|