C22H22BrN3O2S — CID 4237783
N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-bromobenzenesulfonamide (PubChem CID 4237783) has the molecular formula C22H22BrN3O2S and a molecular weight of 472.41 g/mol. Its IUPAC name is N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-bromobenzenesulfonamide.
| Compound Name | N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-bromobenzenesulfonamide |
|---|---|
| PubChem CID | 4237783 |
| Molecular Formula | C22H22BrN3O2S |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | N-[[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-bromobenzenesulfonamide |
| SMILES | CCN(Cc1ccccc1)c1ccc(C=NNS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H22BrN3O2S/c1-2-26(17-19-6-4-3-5-7-19)21-12-8-18(9-13-21)16-24-25-29(27,28)22-14-10-20(23)11-15-22/h3-16,25H,2,17H2,1H3 |
| InChIKey | DCTGBEGSFMSKMZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|