C24H27N3O3S — CID 110516650
N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-ethoxybenzenesulfonamide (PubChem CID 110516650) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110516650 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[(E)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N/N=C/c2ccc(N(CC)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-3-27(19-21-8-6-5-7-9-21)22-12-10-20(11-13-22)18-25-26-31(28,29)24-16-14-23(15-17-24)30-4-2/h5-18,26H,3-4,19H2,1-2H3/b25-18+ |
| InChIKey | BNZOSFINCOIMDH-XIEYBQDHSA-N |
| XLogP | 4.42 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|