C19H24N3O3S- — CID 3667454
4-[2-[[4-(dipropylamino)phenyl]methylidene]hydrazinyl]benzenesulfonate (PubChem CID 3667454) has the molecular formula C19H24N3O3S- and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-[2-[[4-(dipropylamino)phenyl]methylidene]hydrazinyl]benzenesulfonate.
| Compound Name | 4-[2-[[4-(dipropylamino)phenyl]methylidene]hydrazinyl]benzenesulfonate |
|---|---|
| PubChem CID | 3667454 |
| Molecular Formula | C19H24N3O3S- |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-[2-[[4-(dipropylamino)phenyl]methylidene]hydrazinyl]benzenesulfonate |
| SMILES | CCCN(CCC)c1ccc(C=NNc2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-3-13-22(14-4-2)18-9-5-16(6-10-18)15-20-21-17-7-11-19(12-8-17)26(23,24)25/h5-12,15,21H,3-4,13-14H2,1-2H3,(H,23,24,25)/p-1 |
| InChIKey | QGYPVLVAEWPKSL-UHFFFAOYSA-M |
| XLogP | 3.66 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|