C18H16ClN3O3S — CID 139904463
4-[2-[(4-chlorophenyl)methylidene]hydrazinyl]benzenesulfonate;pyridin-1-ium (PubChem CID 139904463) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is 4-[2-[(4-chlorophenyl)methylidene]hydrazinyl]benzenesulfonate;pyridin-1-ium.
| Compound Name | 4-[2-[(4-chlorophenyl)methylidene]hydrazinyl]benzenesulfonate;pyridin-1-ium |
|---|---|
| PubChem CID | 139904463 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 4-[2-[(4-chlorophenyl)methylidene]hydrazinyl]benzenesulfonate;pyridin-1-ium |
| SMILES | O=S(=O)([O-])c1ccc(NN=Cc2ccc(Cl)cc2)cc1.c1cc[nH+]cc1 |
| InChI | InChI=1S/C13H11ClN2O3S.C5H5N/c14-11-3-1-10(2-4-11)9-15-16-12-5-7-13(8-6-12)20(17,18)19;1-2-4-6-5-3-1/h1-9,16H,(H,17,18,19);1-5H |
| InChIKey | NRVGPDQRSTXIOT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|