About bis(4-chlorobenzenesulfonate);mercury(2+)
bis(4-chlorobenzenesulfonate);mercury(2+) (PubChem CID 22604664) has the molecular formula C12H8Cl2HgO6S2
and a molecular weight of 583.82 g/mol. Its IUPAC name is bis(4-chlorobenzenesulfonate);mercury(2+).
Molecular Properties
| Compound Name | bis(4-chlorobenzenesulfonate);mercury(2+) |
| PubChem CID | 22604664 |
| Molecular Formula | C12H8Cl2HgO6S2 |
| Molecular Weight | 583.82 g/mol |
| Exact Mass | 583.88 |
| IUPAC Name | bis(4-chlorobenzenesulfonate);mercury(2+) |
| SMILES | O=S(=O)([O-])c1ccc(Cl)cc1.O=S(=O)([O-])c1ccc(Cl)cc1.[Hg+2] |
| InChI | InChI=1S/2C6H5ClO3S.Hg/c2*7-5-1-3-6(4-2-5)11(8,9)10;/h2*1-4H,(H,8,9,10);/q;;+2/p-2 |
| InChIKey | HEQGAQMASYWEFT-UHFFFAOYSA-L |
| XLogP | 2.49 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 583.82 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4-chlorobenzenesulfonate);mercury(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-chlorobenzenesulfonate);mercury(2+)?
The IUPAC name of bis(4-chlorobenzenesulfonate);mercury(2+) (CID 22604664) is bis(4-chlorobenzenesulfonate);mercury(2+).
What is the SMILES notation for bis(4-chlorobenzenesulfonate);mercury(2+)?
The canonical SMILES for bis(4-chlorobenzenesulfonate);mercury(2+) is O=S(=O)([O-])c1ccc(Cl)cc1.O=S(=O)([O-])c1ccc(Cl)cc1.[Hg+2].
What is the InChIKey of bis(4-chlorobenzenesulfonate);mercury(2+)?
The InChIKey is HEQGAQMASYWEFT-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H5ClO3S.Hg/c2*7-5-1-3-6(4-2-5)11(8,9)10;/h2*1-4H,(H,8,9,10);/q;;+2/p-2.
What are the key properties of bis(4-chlorobenzenesulfonate);mercury(2+)?
bis(4-chlorobenzenesulfonate);mercury(2+) has a molecular weight of 583.82 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-chlorobenzenesulfonate);mercury(2+) is sourced from PubChem (CID 22604664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).