About (4-chlorophenyl)azanium;4-methylbenzenesulfonate
(4-chlorophenyl)azanium;4-methylbenzenesulfonate (PubChem CID 139082434) has the molecular formula C13H14ClNO3S
and a molecular weight of 299.78 g/mol. Its IUPAC name is (4-chlorophenyl)azanium;4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (4-chlorophenyl)azanium;4-methylbenzenesulfonate |
| PubChem CID | 139082434 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (4-chlorophenyl)azanium;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.[NH3+]c1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H8O3S.C6H6ClN/c1-6-2-4-7(5-3-6)11(8,9)10;7-5-1-3-6(8)4-2-5/h2-5H,1H3,(H,8,9,10);1-4H,8H2 |
| InChIKey | JRBWXPJGGKKIOX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)azanium;4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)azanium;4-methylbenzenesulfonate?
The IUPAC name of (4-chlorophenyl)azanium;4-methylbenzenesulfonate (CID 139082434) is (4-chlorophenyl)azanium;4-methylbenzenesulfonate.
What is the SMILES notation for (4-chlorophenyl)azanium;4-methylbenzenesulfonate?
The canonical SMILES for (4-chlorophenyl)azanium;4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)[O-])cc1.[NH3+]c1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)azanium;4-methylbenzenesulfonate?
The InChIKey is JRBWXPJGGKKIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C6H6ClN/c1-6-2-4-7(5-3-6)11(8,9)10;7-5-1-3-6(8)4-2-5/h2-5H,1H3,(H,8,9,10);1-4H,8H2.
What are the key properties of (4-chlorophenyl)azanium;4-methylbenzenesulfonate?
(4-chlorophenyl)azanium;4-methylbenzenesulfonate has a molecular weight of 299.78 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)azanium;4-methylbenzenesulfonate is sourced from PubChem (CID 139082434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).