About potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane
potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane (PubChem CID 42618709) has the molecular formula C6H4ClKO2S2
and a molecular weight of 246.78 g/mol. Its IUPAC name is potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane.
Molecular Properties
| Compound Name | potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane |
| PubChem CID | 42618709 |
| Molecular Formula | C6H4ClKO2S2 |
| Molecular Weight | 246.78 g/mol |
| Exact Mass | 245.90 |
| IUPAC Name | potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane |
| SMILES | O=S([O-])(=S)c1ccc(Cl)cc1.[K+] |
| InChI | InChI=1S/C6H5ClO2S2.K/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,(H,8,9,10);/q;+1/p-1 |
| InChIKey | HVBBKJNJUNOJPF-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.78 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane?
The IUPAC name of potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane (CID 42618709) is potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane.
What is the SMILES notation for potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane?
The canonical SMILES for potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane is O=S([O-])(=S)c1ccc(Cl)cc1.[K+].
What is the InChIKey of potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane?
The InChIKey is HVBBKJNJUNOJPF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5ClO2S2.K/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,(H,8,9,10);/q;+1/p-1.
What are the key properties of potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane?
potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane has a molecular weight of 246.78 g/mol, XLogP of -1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (4-chlorophenyl)-oxido-oxo-sulfanylidene-λ6-sulfane is sourced from PubChem (CID 42618709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).