About potassium;4-chloro-N-methylbenzenesulfonamide;hydride
potassium;4-chloro-N-methylbenzenesulfonamide;hydride (PubChem CID 173400421) has the molecular formula C7H9ClKNO2S
and a molecular weight of 245.77 g/mol. Its IUPAC name is potassium;4-chloro-N-methylbenzenesulfonamide;hydride.
Molecular Properties
| Compound Name | potassium;4-chloro-N-methylbenzenesulfonamide;hydride |
| PubChem CID | 173400421 |
| Molecular Formula | C7H9ClKNO2S |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | potassium;4-chloro-N-methylbenzenesulfonamide;hydride |
| SMILES | CNS(=O)(=O)c1ccc(Cl)cc1.[H-].[K+] |
| InChI | InChI=1S/C7H8ClNO2S.K.H/c1-9-12(10,11)7-4-2-6(8)3-5-7;;/h2-5,9H,1H3;;/q;+1;-1 |
| InChIKey | VQEUGSVLWOORFL-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;4-chloro-N-methylbenzenesulfonamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;4-chloro-N-methylbenzenesulfonamide;hydride?
The IUPAC name of potassium;4-chloro-N-methylbenzenesulfonamide;hydride (CID 173400421) is potassium;4-chloro-N-methylbenzenesulfonamide;hydride.
What is the SMILES notation for potassium;4-chloro-N-methylbenzenesulfonamide;hydride?
The canonical SMILES for potassium;4-chloro-N-methylbenzenesulfonamide;hydride is CNS(=O)(=O)c1ccc(Cl)cc1.[H-].[K+].
What is the InChIKey of potassium;4-chloro-N-methylbenzenesulfonamide;hydride?
The InChIKey is VQEUGSVLWOORFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO2S.K.H/c1-9-12(10,11)7-4-2-6(8)3-5-7;;/h2-5,9H,1H3;;/q;+1;-1.
What are the key properties of potassium;4-chloro-N-methylbenzenesulfonamide;hydride?
potassium;4-chloro-N-methylbenzenesulfonamide;hydride has a molecular weight of 245.77 g/mol, XLogP of -1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;4-chloro-N-methylbenzenesulfonamide;hydride is sourced from PubChem (CID 173400421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).