C10H16N2O2S — CID 84692052
4-(2-aminopropan-2-yl)-N-methylbenzenesulfonamide (PubChem CID 84692052) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-(2-aminopropan-2-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-(2-aminopropan-2-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 84692052 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-(2-aminopropan-2-yl)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C(C)(C)N)cc1 |
| InChI | InChI=1S/C10H16N2O2S/c1-10(2,11)8-4-6-9(7-5-8)15(13,14)12-3/h4-7,12H,11H2,1-3H3 |
| InChIKey | GPDXSYQYZGWUIN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |