C20H24N4O2S — CID 3468738
N-[[4-(dipropylamino)phenyl]methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 3468738) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[[4-(dipropylamino)phenyl]methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-[[4-(dipropylamino)phenyl]methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 3468738 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[[4-(dipropylamino)phenyl]methylideneamino]-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | CCCN(CCC)c1ccc(C=NNC2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H24N4O2S/c1-3-13-24(14-4-2)17-11-9-16(10-12-17)15-21-22-20-18-7-5-6-8-19(18)27(25,26)23-20/h5-12,15H,3-4,13-14H2,1-2H3,(H,22,23) |
| InChIKey | SIIOCBAIFONPTL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|