C15H12N4O4S — CID 168532831
[[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]methylideneamino]urea (PubChem CID 168532831) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is [[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]methylideneamino]urea.
| Compound Name | [[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168532831 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1ccc(OC2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C15H12N4O4S/c16-15(20)18-17-9-10-5-7-11(8-6-10)23-14-12-3-1-2-4-13(12)24(21,22)19-14/h1-9H,(H3,16,18,20) |
| InChIKey | VKKQDQJUPFYYSW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|