C14H11F2N3O2 — CID 54511746
[[4-(3,5-difluorophenoxy)phenyl]methylideneamino]urea (PubChem CID 54511746) has the molecular formula C14H11F2N3O2 and a molecular weight of 291.26 g/mol. Its IUPAC name is [[4-(3,5-difluorophenoxy)phenyl]methylideneamino]urea.
| Compound Name | [[4-(3,5-difluorophenoxy)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 54511746 |
| Molecular Formula | C14H11F2N3O2 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | [[4-(3,5-difluorophenoxy)phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1ccc(Oc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C14H11F2N3O2/c15-10-5-11(16)7-13(6-10)21-12-3-1-9(2-4-12)8-18-19-14(17)20/h1-8H,(H3,17,19,20) |
| InChIKey | YJPVVRHMIMEGPY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|