About [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane
[(E)-(4-ethoxyphenyl)methylideneamino]urea;methane (PubChem CID 18532062) has the molecular formula C11H17N3O2
and a molecular weight of 223.28 g/mol. Its IUPAC name is [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane.
Molecular Properties
| Compound Name | [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane |
| PubChem CID | 18532062 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane |
| SMILES | C.CCOc1ccc(/C=N/NC(N)=O)cc1 |
| InChI | InChI=1S/C10H13N3O2.CH4/c1-2-15-9-5-3-8(4-6-9)7-12-13-10(11)14;/h3-7H,2H2,1H3,(H3,11,13,14);1H4/b12-7+; |
| InChIKey | VMSHRPFHIMDXKC-RRAJOLSVSA-N |
| XLogP | 1.72 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane?
The IUPAC name of [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane (CID 18532062) is [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane.
What is the SMILES notation for [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane?
The canonical SMILES for [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane is C.CCOc1ccc(/C=N/NC(N)=O)cc1.
What is the InChIKey of [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane?
The InChIKey is VMSHRPFHIMDXKC-RRAJOLSVSA-N. The full InChI is InChI=1S/C10H13N3O2.CH4/c1-2-15-9-5-3-8(4-6-9)7-12-13-10(11)14;/h3-7H,2H2,1H3,(H3,11,13,14);1H4/b12-7+;.
What are the key properties of [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane?
[(E)-(4-ethoxyphenyl)methylideneamino]urea;methane has a molecular weight of 223.28 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(4-ethoxyphenyl)methylideneamino]urea;methane is sourced from PubChem (CID 18532062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).