About methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate
methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate (PubChem CID 18532072) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate.
Molecular Properties
| Compound Name | methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate |
| PubChem CID | 18532072 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate |
| SMILES | C.CCOc1ccc(/C=N/NC(=O)OC)cc1 |
| InChI | InChI=1S/C11H14N2O3.CH4/c1-3-16-10-6-4-9(5-7-10)8-12-13-11(14)15-2;/h4-8H,3H2,1-2H3,(H,13,14);1H4/b12-8+; |
| InChIKey | KGKDCPFOUBGPPI-MXZHIVQLSA-N |
| XLogP | 2.41 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate?
The IUPAC name of methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate (CID 18532072) is methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate.
What is the SMILES notation for methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate?
The canonical SMILES for methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate is C.CCOc1ccc(/C=N/NC(=O)OC)cc1.
What is the InChIKey of methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate?
The InChIKey is KGKDCPFOUBGPPI-MXZHIVQLSA-N. The full InChI is InChI=1S/C11H14N2O3.CH4/c1-3-16-10-6-4-9(5-7-10)8-12-13-11(14)15-2;/h4-8H,3H2,1-2H3,(H,13,14);1H4/b12-8+;.
What are the key properties of methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate?
methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate has a molecular weight of 238.29 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl N-[(E)-(4-ethoxyphenyl)methylideneamino]carbamate is sourced from PubChem (CID 18532072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).