C13H16N2O3 — CID 54389739
methyl N-[[4-(cyclopropylmethoxy)phenyl]methylideneamino]carbamate (PubChem CID 54389739) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl N-[[4-(cyclopropylmethoxy)phenyl]methylideneamino]carbamate.
| Compound Name | methyl N-[[4-(cyclopropylmethoxy)phenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 54389739 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl N-[[4-(cyclopropylmethoxy)phenyl]methylideneamino]carbamate |
| SMILES | COC(=O)NN=Cc1ccc(OCC2CC2)cc1 |
| InChI | InChI=1S/C13H16N2O3/c1-17-13(16)15-14-8-10-4-6-12(7-5-10)18-9-11-2-3-11/h4-8,11H,2-3,9H2,1H3,(H,15,16) |
| InChIKey | VFTVBDARGDPEJH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|