C24H24N4O4 — CID 167450595
6-[4-(cyclopropylmethoxy)phenyl]-N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide (PubChem CID 167450595) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 6-[4-(cyclopropylmethoxy)phenyl]-N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide.
| Compound Name | 6-[4-(cyclopropylmethoxy)phenyl]-N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167450595 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 6-[4-(cyclopropylmethoxy)phenyl]-N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cncc(-c3ccc(OCC4CC4)cc3)n2)cc(OC)c1 |
| InChI | InChI=1S/C24H24N4O4/c1-30-20-9-17(10-21(11-20)31-2)12-26-28-24(29)23-14-25-13-22(27-23)18-5-7-19(8-6-18)32-15-16-3-4-16/h5-14,16H,3-4,15H2,1-2H3,(H,28,29)/b26-12+ |
| InChIKey | KPWHRDZTQCXAAK-RPPGKUMJSA-N |
| XLogP | 3.71 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|