C25H29N5O4 — CID 167450813
N-[(E)-[3-[2-(dimethylamino)ethoxy]-5-methoxyphenyl]methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide (PubChem CID 167450813) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[(E)-[3-[2-(dimethylamino)ethoxy]-5-methoxyphenyl]methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide.
| Compound Name | N-[(E)-[3-[2-(dimethylamino)ethoxy]-5-methoxyphenyl]methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167450813 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-[(E)-[3-[2-(dimethylamino)ethoxy]-5-methoxyphenyl]methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide |
| SMILES | CCOc1ccc(-c2cncc(C(=O)N/N=C/c3cc(OC)cc(OCCN(C)C)c3)n2)cc1 |
| InChI | InChI=1S/C25H29N5O4/c1-5-33-20-8-6-19(7-9-20)23-16-26-17-24(28-23)25(31)29-27-15-18-12-21(32-4)14-22(13-18)34-11-10-30(2)3/h6-9,12-17H,5,10-11H2,1-4H3,(H,29,31)/b27-15+ |
| InChIKey | QBTIYGHNENHLMS-JFLMPSFJSA-N |
| XLogP | 3.26 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|