C22H21ClN4O4 — CID 175559849
5-chloro-N-[(3,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide (PubChem CID 175559849) has the molecular formula C22H21ClN4O4 and a molecular weight of 440.89 g/mol. Its IUPAC name is 5-chloro-N-[(3,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-[(3,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 175559849 |
| Molecular Formula | C22H21ClN4O4 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 5-chloro-N-[(3,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(=O)NN=Cc3cc(OC)cc(OC)c3)cnc2Cl)cc1 |
| InChI | InChI=1S/C22H21ClN4O4/c1-4-31-16-7-5-15(6-8-16)20-21(23)24-13-19(26-20)22(28)27-25-12-14-9-17(29-2)11-18(10-14)30-3/h5-13H,4H2,1-3H3,(H,27,28) |
| InChIKey | BUBZJYDHPAHTKF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|