C24H26N4O4 — CID 175559912
6-(4-butoxyphenyl)-N-[(3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide (PubChem CID 175559912) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 6-(4-butoxyphenyl)-N-[(3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide.
| Compound Name | 6-(4-butoxyphenyl)-N-[(3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 175559912 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 6-(4-butoxyphenyl)-N-[(3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide |
| SMILES | CCCCOc1ccc(-c2cncc(C(=O)NN=Cc3cc(OC)cc(OC)c3)n2)cc1 |
| InChI | InChI=1S/C24H26N4O4/c1-4-5-10-32-19-8-6-18(7-9-19)22-15-25-16-23(27-22)24(29)28-26-14-17-11-20(30-2)13-21(12-17)31-3/h6-9,11-16H,4-5,10H2,1-3H3,(H,28,29) |
| InChIKey | ZXMZQSSITMSTKQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|