C22H21FN4O4 — CID 175559902
6-(4-ethoxyphenyl)-N-[(4-fluoro-3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide (PubChem CID 175559902) has the molecular formula C22H21FN4O4 and a molecular weight of 424.43 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-N-[(4-fluoro-3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide.
| Compound Name | 6-(4-ethoxyphenyl)-N-[(4-fluoro-3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 175559902 |
| Molecular Formula | C22H21FN4O4 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 6-(4-ethoxyphenyl)-N-[(4-fluoro-3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide |
| SMILES | CCOc1ccc(-c2cncc(C(=O)NN=Cc3cc(OC)c(F)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C22H21FN4O4/c1-4-31-16-7-5-15(6-8-16)17-12-24-13-18(26-17)22(28)27-25-11-14-9-19(29-2)21(23)20(10-14)30-3/h5-13H,4H2,1-3H3,(H,27,28) |
| InChIKey | PMMGVBSVXYYCTP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|