C22H22N4O4 — CID 175559864
N-[(2,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide (PubChem CID 175559864) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 175559864 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)pyrazine-2-carboxamide |
| SMILES | CCOc1ccc(-c2cncc(C(=O)NN=Cc3cc(OC)ccc3OC)n2)cc1 |
| InChI | InChI=1S/C22H22N4O4/c1-4-30-17-7-5-15(6-8-17)19-13-23-14-20(25-19)22(27)26-24-12-16-11-18(28-2)9-10-21(16)29-3/h5-14H,4H2,1-3H3,(H,26,27) |
| InChIKey | KJFXVAHPAFFCTE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|