C23H22FN3O4 — CID 174239572
N-[(3,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)-4-fluoropyridine-2-carboxamide (PubChem CID 174239572) has the molecular formula C23H22FN3O4 and a molecular weight of 423.44 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)-4-fluoropyridine-2-carboxamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)-4-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 174239572 |
| Molecular Formula | C23H22FN3O4 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-6-(4-ethoxyphenyl)-4-fluoropyridine-2-carboxamide |
| SMILES | CCOc1ccc(-c2cc(F)cc(C(=O)NN=Cc3cc(OC)cc(OC)c3)n2)cc1 |
| InChI | InChI=1S/C23H22FN3O4/c1-4-31-18-7-5-16(6-8-18)21-11-17(24)12-22(26-21)23(28)27-25-14-15-9-19(29-2)13-20(10-15)30-3/h5-14H,4H2,1-3H3,(H,27,28) |
| InChIKey | LNSNVNPZCASNGY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|