C23H23FN4O5 — CID 167450798
6-(4-ethoxy-2-methoxyphenyl)-N-[(E)-(4-fluoro-3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide (PubChem CID 167450798) has the molecular formula C23H23FN4O5 and a molecular weight of 454.46 g/mol. Its IUPAC name is 6-(4-ethoxy-2-methoxyphenyl)-N-[(E)-(4-fluoro-3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide.
| Compound Name | 6-(4-ethoxy-2-methoxyphenyl)-N-[(E)-(4-fluoro-3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167450798 |
| Molecular Formula | C23H23FN4O5 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 6-(4-ethoxy-2-methoxyphenyl)-N-[(E)-(4-fluoro-3,5-dimethoxyphenyl)methylideneamino]pyrazine-2-carboxamide |
| SMILES | CCOc1ccc(-c2cncc(C(=O)N/N=C/c3cc(OC)c(F)c(OC)c3)n2)c(OC)c1 |
| InChI | InChI=1S/C23H23FN4O5/c1-5-33-15-6-7-16(19(10-15)30-2)17-12-25-13-18(27-17)23(29)28-26-11-14-8-20(31-3)22(24)21(9-14)32-4/h6-13H,5H2,1-4H3,(H,28,29)/b26-11+ |
| InChIKey | OLJBHQKWIQXXQP-KBKYJPHKSA-N |
| XLogP | 3.47 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|