C22H19F3N4O5 — CID 174239640
N-[(3,5-dimethoxyphenyl)methylideneamino]-6-[4-methoxy-2-(trifluoromethoxy)phenyl]pyrazine-2-carboxamide (PubChem CID 174239640) has the molecular formula C22H19F3N4O5 and a molecular weight of 476.41 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methylideneamino]-6-[4-methoxy-2-(trifluoromethoxy)phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-6-[4-methoxy-2-(trifluoromethoxy)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174239640 |
| Molecular Formula | C22H19F3N4O5 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-6-[4-methoxy-2-(trifluoromethoxy)phenyl]pyrazine-2-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2cncc(-c3ccc(OC)cc3OC(F)(F)F)n2)cc(OC)c1 |
| InChI | InChI=1S/C22H19F3N4O5/c1-31-14-4-5-17(20(9-14)34-22(23,24)25)18-11-26-12-19(28-18)21(30)29-27-10-13-6-15(32-2)8-16(7-13)33-3/h4-12H,1-3H3,(H,29,30) |
| InChIKey | IXSNKWYCUMIINS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|