C13H11F3N4O3 — CID 167450736
6-[4-methoxy-2-(trifluoromethoxy)phenyl]pyrazine-2-carbohydrazide (PubChem CID 167450736) has the molecular formula C13H11F3N4O3 and a molecular weight of 328.25 g/mol. Its IUPAC name is 6-[4-methoxy-2-(trifluoromethoxy)phenyl]pyrazine-2-carbohydrazide.
| Compound Name | 6-[4-methoxy-2-(trifluoromethoxy)phenyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 167450736 |
| Molecular Formula | C13H11F3N4O3 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 6-[4-methoxy-2-(trifluoromethoxy)phenyl]pyrazine-2-carbohydrazide |
| SMILES | COc1ccc(-c2cncc(C(=O)NN)n2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F3N4O3/c1-22-7-2-3-8(11(4-7)23-13(14,15)16)9-5-18-6-10(19-9)12(21)20-17/h2-6H,17H2,1H3,(H,20,21) |
| InChIKey | UKUSTCYALILOEM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|