C22H18F3N3O4 — CID 174239479
N-[(3,5-dimethoxyphenyl)methylideneamino]-5-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 174239479) has the molecular formula C22H18F3N3O4 and a molecular weight of 445.40 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methylideneamino]-5-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-5-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 174239479 |
| Molecular Formula | C22H18F3N3O4 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-5-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2cncc(-c3ccc(OC(F)(F)F)cc3)c2)cc(OC)c1 |
| InChI | InChI=1S/C22H18F3N3O4/c1-30-19-7-14(8-20(10-19)31-2)11-27-28-21(29)17-9-16(12-26-13-17)15-3-5-18(6-4-15)32-22(23,24)25/h3-13H,1-2H3,(H,28,29) |
| InChIKey | QRWMNEGGCFCQAE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|