C19H24ClN5O2 — CID 157053375
1,2-bis[(4-ethoxyphenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 157053375) has the molecular formula C19H24ClN5O2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 1,2-bis[(4-ethoxyphenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[(4-ethoxyphenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 157053375 |
| Molecular Formula | C19H24ClN5O2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1,2-bis[(4-ethoxyphenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | CCOc1ccc(C=NN=C(N)NN=Cc2ccc(OCC)cc2)cc1.Cl |
| InChI | InChI=1S/C19H23N5O2.ClH/c1-3-25-17-9-5-15(6-10-17)13-21-23-19(20)24-22-14-16-7-11-18(12-8-16)26-4-2;/h5-14H,3-4H2,1-2H3,(H3,20,23,24);1H |
| InChIKey | AUXVTPBKGWQDAR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|