C24H33N5O2 — CID 172923446
2-[(E)-(4-butoxyphenyl)methylideneamino]-1-[(E)-(4-pentoxyphenyl)methylideneamino]guanidine (PubChem CID 172923446) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-[(E)-(4-butoxyphenyl)methylideneamino]-1-[(E)-(4-pentoxyphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(E)-(4-butoxyphenyl)methylideneamino]-1-[(E)-(4-pentoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 172923446 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 2-[(E)-(4-butoxyphenyl)methylideneamino]-1-[(E)-(4-pentoxyphenyl)methylideneamino]guanidine |
| SMILES | CCCCCOc1ccc(/C=N/NC(N)=N/N=C/c2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C24H33N5O2/c1-3-5-7-17-31-23-14-10-21(11-15-23)19-27-29-24(25)28-26-18-20-8-12-22(13-9-20)30-16-6-4-2/h8-15,18-19H,3-7,16-17H2,1-2H3,(H3,25,28,29)/b26-18+,27-19+ |
| InChIKey | ZVGZDHNNIIUQRQ-BFNWXZRRSA-N |
| XLogP | 4.71 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|