C33H35N5O2 — CID 172983389
1,2-bis[(E)-[4-(4-propylphenoxy)phenyl]methylideneamino]guanidine (PubChem CID 172983389) has the molecular formula C33H35N5O2 and a molecular weight of 533.68 g/mol. Its IUPAC name is 1,2-bis[(E)-[4-(4-propylphenoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 1,2-bis[(E)-[4-(4-propylphenoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 172983389 |
| Molecular Formula | C33H35N5O2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 1,2-bis[(E)-[4-(4-propylphenoxy)phenyl]methylideneamino]guanidine |
| SMILES | CCCc1ccc(Oc2ccc(/C=N/N=C(N)N/N=C/c3ccc(Oc4ccc(CCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H35N5O2/c1-3-5-25-7-15-29(16-8-25)39-31-19-11-27(12-20-31)23-35-37-33(34)38-36-24-28-13-21-32(22-14-28)40-30-17-9-26(6-4-2)10-18-30/h7-24H,3-6H2,1-2H3,(H3,34,37,38)/b35-23+,36-24+ |
| InChIKey | NFGCTQTWUBKIHA-VJTPSNAYSA-N |
| XLogP | 7.45 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|