C23H31N5 — CID 118918863
1,2-bis[(4-butylphenyl)methylideneamino]guanidine (PubChem CID 118918863) has the molecular formula C23H31N5 and a molecular weight of 377.54 g/mol. Its IUPAC name is 1,2-bis[(4-butylphenyl)methylideneamino]guanidine.
| Compound Name | 1,2-bis[(4-butylphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 118918863 |
| Molecular Formula | C23H31N5 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 1,2-bis[(4-butylphenyl)methylideneamino]guanidine |
| SMILES | CCCCc1ccc(C=N/N=C(\N)NN=Cc2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C23H31N5/c1-3-5-7-19-9-13-21(14-10-19)17-25-27-23(24)28-26-18-22-15-11-20(12-16-22)8-6-4-2/h9-18H,3-8H2,1-2H3,(H3,24,27,28) |
| InChIKey | JCIZXMPLGMBYGZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|