C17H12N4O4S2 — CID 168576179
2-[[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168576179) has the molecular formula C17H12N4O4S2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168576179 |
| Molecular Formula | C17H12N4O4S2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-[[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2ccc(OC3=NS(=O)(=O)c4ccccc43)cc2)N1 |
| InChI | InChI=1S/C17H12N4O4S2/c22-15-10-26-17(19-15)20-18-9-11-5-7-12(8-6-11)25-16-13-3-1-2-4-14(13)27(23,24)21-16/h1-9H,10H2,(H,19,20,22) |
| InChIKey | DKWBUFHZVVWMJN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|