C24H29N5O2 — CID 9259188
N-[(Z)-[4-(dipropylamino)phenyl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide (PubChem CID 9259188) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[(Z)-[4-(dipropylamino)phenyl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(Z)-[4-(dipropylamino)phenyl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9259188 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[(Z)-[4-(dipropylamino)phenyl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCCN(CCC)c1ccc(/C=N\NC(=O)c2nn(CC)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H29N5O2/c1-4-15-28(16-5-2)19-13-11-18(12-14-19)17-25-26-23(30)22-20-9-7-8-10-21(20)24(31)29(6-3)27-22/h7-14,17H,4-6,15-16H2,1-3H3,(H,26,30)/b25-17- |
| InChIKey | ROZCAYVZNGPLEE-UQQQWYQISA-N |
| XLogP | 3.81 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|