C18H15ClN4O4 — CID 135747828
N-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide (PubChem CID 135747828) has the molecular formula C18H15ClN4O4 and a molecular weight of 386.80 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 135747828 |
| Molecular Formula | C18H15ClN4O4 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCn1nc(C(=O)N/N=C/c2cc(O)c(O)c(Cl)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C18H15ClN4O4/c1-2-23-18(27)12-6-4-3-5-11(12)15(22-23)17(26)21-20-9-10-7-13(19)16(25)14(24)8-10/h3-9,24-25H,2H2,1H3,(H,21,26)/b20-9+ |
| InChIKey | FRWHIYUGLSASMY-AWQFTUOYSA-N |
| XLogP | 2.24 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|