C24H22ClN5O2 — CID 55352766
N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide (PubChem CID 55352766) has the molecular formula C24H22ClN5O2 and a molecular weight of 447.93 g/mol. Its IUPAC name is N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55352766 |
| Molecular Formula | C24H22ClN5O2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-ethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCn1nc(C(=O)N/N=C/c2cc(C)n(-c3ccc(Cl)cc3)c2C)c2ccccc2c1=O |
| InChI | InChI=1S/C24H22ClN5O2/c1-4-29-24(32)21-8-6-5-7-20(21)22(28-29)23(31)27-26-14-17-13-15(2)30(16(17)3)19-11-9-18(25)10-12-19/h5-14H,4H2,1-3H3,(H,27,31)/b26-14+ |
| InChIKey | RUEPRIWSCFXFAG-VULFUBBASA-N |
| XLogP | 4.24 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|