C20H18N4O4 — CID 4848661
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3-ethyl-4-oxophthalazine-1-carboxamide (PubChem CID 4848661) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3-ethyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3-ethyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4848661 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-3-ethyl-4-oxophthalazine-1-carboxamide |
| SMILES | CCn1nc(C(=O)NN=Cc2ccc3c(c2)OCCO3)c2ccccc2c1=O |
| InChI | InChI=1S/C20H18N4O4/c1-2-24-20(26)15-6-4-3-5-14(15)18(23-24)19(25)22-21-12-13-7-8-16-17(11-13)28-10-9-27-16/h3-8,11-12H,2,9-10H2,1H3,(H,22,25) |
| InChIKey | LXEHZTJIJRRFQM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|