C18H14N5O5- — CID 9462740
4-[(Z)-[(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinylidene]methyl]-2-nitrophenolate (PubChem CID 9462740) has the molecular formula C18H14N5O5- and a molecular weight of 380.34 g/mol. Its IUPAC name is 4-[(Z)-[(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[(Z)-[(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 9462740 |
| Molecular Formula | C18H14N5O5- |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 4-[(Z)-[(3-ethyl-4-oxophthalazine-1-carbonyl)hydrazinylidene]methyl]-2-nitrophenolate |
| SMILES | CCn1nc(C(=O)N/N=C\c2ccc([O-])c([N+](=O)[O-])c2)c2ccccc2c1=O |
| InChI | InChI=1S/C18H15N5O5/c1-2-22-18(26)13-6-4-3-5-12(13)16(21-22)17(25)20-19-10-11-7-8-15(24)14(9-11)23(27)28/h3-10,24H,2H2,1H3,(H,20,25)/p-1/b19-10- |
| InChIKey | VIZBIAUKNXJEEX-GRSHGNNSSA-M |
| XLogP | 1.16 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|