C14H18 — CID 159360183
cyclohexa-1,3-diene;1,2-xylene (PubChem CID 159360183) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is cyclohexa-1,3-diene;1,2-xylene.
| Compound Name | cyclohexa-1,3-diene;1,2-xylene |
|---|---|
| PubChem CID | 159360183 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | cyclohexa-1,3-diene;1,2-xylene |
| SMILES | C1=CCCC=C1.Cc1ccccc1C |
| InChI | InChI=1S/C8H10.C6H8/c1-7-5-3-4-6-8(7)2;1-2-4-6-5-3-1/h3-6H,1-2H3;1-4H,5-6H2 |
| InChIKey | LILAAWCLXXIIDC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |