C26H29LiOSi — CID 177390908
lithium tert-butyl-[4-(1,2-diphenylethenyl)phenoxy]-dimethylsilane (PubChem CID 177390908) has the molecular formula C26H29LiOSi and a molecular weight of 392.54 g/mol. Its IUPAC name is lithium tert-butyl-[4-(1,2-diphenylethenyl)phenoxy]-dimethylsilane.
| Compound Name | lithium tert-butyl-[4-(1,2-diphenylethenyl)phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 177390908 |
| Molecular Formula | C26H29LiOSi |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | lithium tert-butyl-[4-(1,2-diphenylethenyl)phenoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(/C(=[C-]/c2ccccc2)c2ccccc2)cc1.[Li+] |
| InChI | InChI=1S/C26H29OSi.Li/c1-26(2,3)28(4,5)27-24-18-16-23(17-19-24)25(22-14-10-7-11-15-22)20-21-12-8-6-9-13-21;/h6-19H,1-5H3;/q-1;+1 |
| InChIKey | QPNSAMZFMVXQFF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|