C20H25LiOSi — CID 10448479
lithium tert-butyl-(2,2-diphenylethenoxy)-dimethylsilane (PubChem CID 10448479) has the molecular formula C20H25LiOSi and a molecular weight of 316.45 g/mol. Its IUPAC name is lithium tert-butyl-(2,2-diphenylethenoxy)-dimethylsilane.
| Compound Name | lithium tert-butyl-(2,2-diphenylethenoxy)-dimethylsilane |
|---|---|
| PubChem CID | 10448479 |
| Molecular Formula | C20H25LiOSi |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | lithium tert-butyl-(2,2-diphenylethenoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C-]=C(c1ccccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C20H25OSi.Li/c1-20(2,3)22(4,5)21-16-19(17-12-8-6-9-13-17)18-14-10-7-11-15-18;/h6-15H,1-5H3;/q-1;+1 |
| InChIKey | ROEIBLZJMFZQHM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|