C26H36O2Si — CID 13293861
(4-benzhydrylidene-2-tert-butyloxetan-2-yl)oxy-tert-butyl-dimethylsilane (PubChem CID 13293861) has the molecular formula C26H36O2Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (4-benzhydrylidene-2-tert-butyloxetan-2-yl)oxy-tert-butyl-dimethylsilane.
| Compound Name | (4-benzhydrylidene-2-tert-butyloxetan-2-yl)oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 13293861 |
| Molecular Formula | C26H36O2Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (4-benzhydrylidene-2-tert-butyloxetan-2-yl)oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)C1(O[Si](C)(C)C(C)(C)C)CC(=C(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C26H36O2Si/c1-24(2,3)26(28-29(7,8)25(4,5)6)19-22(27-26)23(20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-18H,19H2,1-8H3 |
| InChIKey | WQUIHMZAKXTJJD-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|