C16H24F2OSi — CID 162540016
tert-butyl-(2,2-difluoro-3-methyl-1-phenylcyclopropyl)oxy-dimethylsilane (PubChem CID 162540016) has the molecular formula C16H24F2OSi and a molecular weight of 298.45 g/mol. Its IUPAC name is tert-butyl-(2,2-difluoro-3-methyl-1-phenylcyclopropyl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(2,2-difluoro-3-methyl-1-phenylcyclopropyl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 162540016 |
| Molecular Formula | C16H24F2OSi |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | tert-butyl-(2,2-difluoro-3-methyl-1-phenylcyclopropyl)oxy-dimethylsilane |
| SMILES | CC1C(F)(F)C1(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H24F2OSi/c1-12-15(16(12,17)18,13-10-8-7-9-11-13)19-20(5,6)14(2,3)4/h7-12H,1-6H3 |
| InChIKey | UNKKOTGCMMXCBK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|