C23H32O2SeSi — CID 15517186
tert-butyl-[(3S,4S)-2,2-dimethyl-4-phenyl-3-phenylselanyloxetan-3-yl]oxy-dimethylsilane (PubChem CID 15517186) has the molecular formula C23H32O2SeSi and a molecular weight of 447.55 g/mol. Its IUPAC name is tert-butyl-[(3S,4S)-2,2-dimethyl-4-phenyl-3-phenylselanyloxetan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S)-2,2-dimethyl-4-phenyl-3-phenylselanyloxetan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 15517186 |
| Molecular Formula | C23H32O2SeSi |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | tert-butyl-[(3S,4S)-2,2-dimethyl-4-phenyl-3-phenylselanyloxetan-3-yl]oxy-dimethylsilane |
| SMILES | CC1(C)O[C@@H](c2ccccc2)[C@]1(O[Si](C)(C)C(C)(C)C)[Se]c1ccccc1 |
| InChI | InChI=1S/C23H32O2SeSi/c1-21(2,3)27(6,7)25-23(26-19-16-12-9-13-17-19)20(24-22(23,4)5)18-14-10-8-11-15-18/h8-17,20H,1-7H3/t20-,23-/m0/s1 |
| InChIKey | ZQIYNNKPJSBYNX-REWPJTCUSA-N |
| XLogP | 5.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|