C23H35Cl3O5Si — CID 14530690
ethyl 2-[(2R,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-phenyl-2-(trichloromethyl)-1,3-dioxan-4-yl]acetate (PubChem CID 14530690) has the molecular formula C23H35Cl3O5Si and a molecular weight of 525.97 g/mol. Its IUPAC name is ethyl 2-[(2R,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-phenyl-2-(trichloromethyl)-1,3-dioxan-4-yl]acetate.
| Compound Name | ethyl 2-[(2R,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-phenyl-2-(trichloromethyl)-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 14530690 |
| Molecular Formula | C23H35Cl3O5Si |
| Molecular Weight | 525.97 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | ethyl 2-[(2R,4S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-phenyl-2-(trichloromethyl)-1,3-dioxan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@]1(O[Si](C)(C)C(C)(C)C)O[C@H](C(Cl)(Cl)Cl)O[C@H](c2ccccc2)C1(C)C |
| InChI | InChI=1S/C23H35Cl3O5Si/c1-9-28-17(27)15-22(31-32(7,8)20(2,3)4)21(5,6)18(16-13-11-10-12-14-16)29-19(30-22)23(24,25)26/h10-14,18-19H,9,15H2,1-8H3/t18-,19-,22+/m1/s1 |
| InChIKey | FKEAOIKHWCFWHH-KNKQGSTJSA-N |
| XLogP | 7.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.97 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|