C18H30O2SSi — CID 101051271
tert-butyl-[(3S,4R)-2,2-dimethyl-3-methylsulfanyl-4-phenyloxetan-3-yl]oxy-dimethylsilane (PubChem CID 101051271) has the molecular formula C18H30O2SSi and a molecular weight of 338.59 g/mol. Its IUPAC name is tert-butyl-[(3S,4R)-2,2-dimethyl-3-methylsulfanyl-4-phenyloxetan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4R)-2,2-dimethyl-3-methylsulfanyl-4-phenyloxetan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101051271 |
| Molecular Formula | C18H30O2SSi |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tert-butyl-[(3S,4R)-2,2-dimethyl-3-methylsulfanyl-4-phenyloxetan-3-yl]oxy-dimethylsilane |
| SMILES | CS[C@@]1(O[Si](C)(C)C(C)(C)C)[C@@H](c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C18H30O2SSi/c1-16(2,3)22(7,8)20-18(21-6)15(19-17(18,4)5)14-12-10-9-11-13-14/h9-13,15H,1-8H3/t15-,18+/m1/s1 |
| InChIKey | LXXVAZILFJRQOQ-QAPCUYQASA-N |
| XLogP | 5.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|