C25H30O6 — CID 23238749
ethyl 2-[(1R,2S,4R,5R,7R,8S)-2-methoxy-4-methyl-7-phenyl-8-phenylmethoxy-3,6-dioxabicyclo[3.2.1]octan-1-yl]acetate (PubChem CID 23238749) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,4R,5R,7R,8S)-2-methoxy-4-methyl-7-phenyl-8-phenylmethoxy-3,6-dioxabicyclo[3.2.1]octan-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,2S,4R,5R,7R,8S)-2-methoxy-4-methyl-7-phenyl-8-phenylmethoxy-3,6-dioxabicyclo[3.2.1]octan-1-yl]acetate |
|---|---|
| PubChem CID | 23238749 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | ethyl 2-[(1R,2S,4R,5R,7R,8S)-2-methoxy-4-methyl-7-phenyl-8-phenylmethoxy-3,6-dioxabicyclo[3.2.1]octan-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@]12[C@@H](OC)O[C@H](C)[C@@H](O[C@@H]1c1ccccc1)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C25H30O6/c1-4-28-20(26)15-25-22(19-13-9-6-10-14-19)31-21(17(2)30-24(25)27-3)23(25)29-16-18-11-7-5-8-12-18/h5-14,17,21-24H,4,15-16H2,1-3H3/t17-,21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | YRFAXWGRBUWFBR-XRNJRMMUSA-N |
| XLogP | 4.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |