C19H26O4 — CID 10313821
(2S,3R,4S,5S)-5-methoxy-4-methyl-4-[(E)-pent-2-en-2-yl]-3-phenylmethoxyoxolane-2-carbaldehyde (PubChem CID 10313821) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-methoxy-4-methyl-4-[(E)-pent-2-en-2-yl]-3-phenylmethoxyoxolane-2-carbaldehyde.
| Compound Name | (2S,3R,4S,5S)-5-methoxy-4-methyl-4-[(E)-pent-2-en-2-yl]-3-phenylmethoxyoxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 10313821 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (2S,3R,4S,5S)-5-methoxy-4-methyl-4-[(E)-pent-2-en-2-yl]-3-phenylmethoxyoxolane-2-carbaldehyde |
| SMILES | CC/C=C(\C)[C@]1(C)[C@@H](OC)O[C@H](C=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H26O4/c1-5-9-14(2)19(3)17(16(12-20)23-18(19)21-4)22-13-15-10-7-6-8-11-15/h6-12,16-18H,5,13H2,1-4H3/b14-9+/t16-,17+,18+,19+/m1/s1 |
| InChIKey | WTVPLSJNPNRVBW-HLPQHZRXSA-N |
| XLogP | 3.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|