C19H30O6 — CID 10316118
(2R,3R)-2-[(2S,3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-3-methyl-4-phenylmethoxyoxolan-3-yl]pentane-2,3-diol (PubChem CID 10316118) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is (2R,3R)-2-[(2S,3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-3-methyl-4-phenylmethoxyoxolan-3-yl]pentane-2,3-diol.
| Compound Name | (2R,3R)-2-[(2S,3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-3-methyl-4-phenylmethoxyoxolan-3-yl]pentane-2,3-diol |
|---|---|
| PubChem CID | 10316118 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (2R,3R)-2-[(2S,3R,4R,5R)-5-(hydroxymethyl)-2-methoxy-3-methyl-4-phenylmethoxyoxolan-3-yl]pentane-2,3-diol |
| SMILES | CC[C@@H](O)[C@](C)(O)[C@]1(C)[C@@H](OC)O[C@H](CO)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H30O6/c1-5-15(21)19(3,22)18(2)16(14(11-20)25-17(18)23-4)24-12-13-9-7-6-8-10-13/h6-10,14-17,20-22H,5,11-12H2,1-4H3/t14-,15-,16+,17+,18+,19+/m1/s1 |
| InChIKey | MNCNWGCQUJWZSF-SVMUCYCZSA-N |
| XLogP | 1.46 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |